C25H27N5O2 — CID 162351830
8-[5-methyl-2-(4-phenoxyanilino)pyrimidin-4-yl]-2,8-diazaspiro[4.5]decan-1-one (PubChem CID 162351830) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is 8-[5-methyl-2-(4-phenoxyanilino)pyrimidin-4-yl]-2,8-diazaspiro[4.5]decan-1-one.
| Compound Name | 8-[5-methyl-2-(4-phenoxyanilino)pyrimidin-4-yl]-2,8-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 162351830 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 8-[5-methyl-2-(4-phenoxyanilino)pyrimidin-4-yl]-2,8-diazaspiro[4.5]decan-1-one |
| SMILES | Cc1cnc(Nc2ccc(Oc3ccccc3)cc2)nc1N1CCC2(CCNC2=O)CC1 |
| InChI | InChI=1S/C25H27N5O2/c1-18-17-27-24(28-19-7-9-21(10-8-19)32-20-5-3-2-4-6-20)29-22(18)30-15-12-25(13-16-30)11-14-26-23(25)31/h2-10,17H,11-16H2,1H3,(H,26,31)(H,27,28,29) |
| InChIKey | ZMKLNNBIGBHZIR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |