C19H31FN4 — CID 143719345
3-fluoro-N-methyl-4-[4-(4-propan-2-ylpiperazin-1-yl)piperidin-1-yl]aniline (PubChem CID 143719345) has the molecular formula C19H31FN4 and a molecular weight of 334.48 g/mol. Its IUPAC name is 3-fluoro-N-methyl-4-[4-(4-propan-2-ylpiperazin-1-yl)piperidin-1-yl]aniline.
| Compound Name | 3-fluoro-N-methyl-4-[4-(4-propan-2-ylpiperazin-1-yl)piperidin-1-yl]aniline |
|---|---|
| PubChem CID | 143719345 |
| Molecular Formula | C19H31FN4 |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 3-fluoro-N-methyl-4-[4-(4-propan-2-ylpiperazin-1-yl)piperidin-1-yl]aniline |
| SMILES | CNc1ccc(N2CCC(N3CCN(C(C)C)CC3)CC2)c(F)c1 |
| InChI | InChI=1S/C19H31FN4/c1-15(2)22-10-12-23(13-11-22)17-6-8-24(9-7-17)19-5-4-16(21-3)14-18(19)20/h4-5,14-15,17,21H,6-13H2,1-3H3 |
| InChIKey | IBLRYZVXGZXCDB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|