C19H21F4N3 — CID 175200901
3-fluoro-N-methyl-4-[4-[4-(trifluoromethyl)phenyl]-1,4-diazepan-1-yl]aniline (PubChem CID 175200901) has the molecular formula C19H21F4N3 and a molecular weight of 367.39 g/mol. Its IUPAC name is 3-fluoro-N-methyl-4-[4-[4-(trifluoromethyl)phenyl]-1,4-diazepan-1-yl]aniline.
| Compound Name | 3-fluoro-N-methyl-4-[4-[4-(trifluoromethyl)phenyl]-1,4-diazepan-1-yl]aniline |
|---|---|
| PubChem CID | 175200901 |
| Molecular Formula | C19H21F4N3 |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 3-fluoro-N-methyl-4-[4-[4-(trifluoromethyl)phenyl]-1,4-diazepan-1-yl]aniline |
| SMILES | CNc1ccc(N2CCCN(c3ccc(C(F)(F)F)cc3)CC2)c(F)c1 |
| InChI | InChI=1S/C19H21F4N3/c1-24-15-5-8-18(17(20)13-15)26-10-2-9-25(11-12-26)16-6-3-14(4-7-16)19(21,22)23/h3-8,13,24H,2,9-12H2,1H3 |
| InChIKey | CIQRVXRPPHOXBG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|