C18H21F4N5 — CID 177203884
2-N-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]-5-(trifluoromethyl)pyridine-2,4-diamine (PubChem CID 177203884) has the molecular formula C18H21F4N5 and a molecular weight of 383.39 g/mol. Its IUPAC name is 2-N-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]-5-(trifluoromethyl)pyridine-2,4-diamine.
| Compound Name | 2-N-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]-5-(trifluoromethyl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 177203884 |
| Molecular Formula | C18H21F4N5 |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 2-N-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]-5-(trifluoromethyl)pyridine-2,4-diamine |
| SMILES | CN1CCCN(c2ccc(Nc3cc(N)c(C(F)(F)F)cn3)cc2F)CC1 |
| InChI | InChI=1S/C18H21F4N5/c1-26-5-2-6-27(8-7-26)16-4-3-12(9-14(16)19)25-17-10-15(23)13(11-24-17)18(20,21)22/h3-4,9-11H,2,5-8H2,1H3,(H3,23,24,25) |
| InChIKey | YWQGVAWEKQPENK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|