C15H20ClF4N3O2 — CID 47002515
2,2,2-trifluoroethyl N-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]carbamate;hydrochloride (PubChem CID 47002515) has the molecular formula C15H20ClF4N3O2 and a molecular weight of 385.79 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]carbamate;hydrochloride.
| Compound Name | 2,2,2-trifluoroethyl N-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 47002515 |
| Molecular Formula | C15H20ClF4N3O2 |
| Molecular Weight | 385.79 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]carbamate;hydrochloride |
| SMILES | CN1CCCN(c2ccc(NC(=O)OCC(F)(F)F)cc2F)CC1.Cl |
| InChI | InChI=1S/C15H19F4N3O2.ClH/c1-21-5-2-6-22(8-7-21)13-4-3-11(9-12(13)16)20-14(23)24-10-15(17,18)19;/h3-4,9H,2,5-8,10H2,1H3,(H,20,23);1H |
| InChIKey | JORIENZFIYTMIG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.79 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|