C18H29FN4O2 — CID 47092725
1-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]-3-(4-methoxybutan-2-yl)urea (PubChem CID 47092725) has the molecular formula C18H29FN4O2 and a molecular weight of 352.45 g/mol. Its IUPAC name is 1-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]-3-(4-methoxybutan-2-yl)urea.
| Compound Name | 1-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]-3-(4-methoxybutan-2-yl)urea |
|---|---|
| PubChem CID | 47092725 |
| Molecular Formula | C18H29FN4O2 |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 1-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]-3-(4-methoxybutan-2-yl)urea |
| SMILES | COCCC(C)NC(=O)Nc1ccc(N2CCCN(C)CC2)c(F)c1 |
| InChI | InChI=1S/C18H29FN4O2/c1-14(7-12-25-3)20-18(24)21-15-5-6-17(16(19)13-15)23-9-4-8-22(2)10-11-23/h5-6,13-14H,4,7-12H2,1-3H3,(H2,20,21,24) |
| InChIKey | RLEBXRKTHLRGHR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|