C23H38FN5O2 — CID 52518349
1-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]-3-[(2S)-4-methyl-2-morpholin-4-ylpentyl]urea (PubChem CID 52518349) has the molecular formula C23H38FN5O2 and a molecular weight of 435.59 g/mol. Its IUPAC name is 1-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]-3-[(2S)-4-methyl-2-morpholin-4-ylpentyl]urea.
| Compound Name | 1-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]-3-[(2S)-4-methyl-2-morpholin-4-ylpentyl]urea |
|---|---|
| PubChem CID | 52518349 |
| Molecular Formula | C23H38FN5O2 |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.30 |
| IUPAC Name | 1-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]-3-[(2S)-4-methyl-2-morpholin-4-ylpentyl]urea |
| SMILES | CC(C)CC(CNC(=O)Nc1ccc(N2CCCN(C)CC2)c(F)c1)N1CCOCC1 |
| InChI | InChI=1S/C23H38FN5O2/c1-18(2)15-20(28-11-13-31-14-12-28)17-25-23(30)26-19-5-6-22(21(24)16-19)29-8-4-7-27(3)9-10-29/h5-6,16,18,20H,4,7-15,17H2,1-3H3,(H2,25,26,30) |
| InChIKey | BEFQYKLDDXKGGU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|