C21H32N4O3 — CID 55834797
4-[(4-methyl-2-morpholin-4-ylpentyl)carbamoylamino]-N-prop-2-enylbenzamide (PubChem CID 55834797) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is 4-[(4-methyl-2-morpholin-4-ylpentyl)carbamoylamino]-N-prop-2-enylbenzamide.
| Compound Name | 4-[(4-methyl-2-morpholin-4-ylpentyl)carbamoylamino]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 55834797 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 4-[(4-methyl-2-morpholin-4-ylpentyl)carbamoylamino]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccc(NC(=O)NCC(CC(C)C)N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H32N4O3/c1-4-9-22-20(26)17-5-7-18(8-6-17)24-21(27)23-15-19(14-16(2)3)25-10-12-28-13-11-25/h4-8,16,19H,1,9-15H2,2-3H3,(H,22,26)(H2,23,24,27) |
| InChIKey | PJUQQZMDXQMXQL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|