C20H32N4O4 — CID 55744114
N-[2-methoxy-4-[(4-methyl-2-morpholin-4-ylpentyl)carbamoylamino]phenyl]acetamide (PubChem CID 55744114) has the molecular formula C20H32N4O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is N-[2-methoxy-4-[(4-methyl-2-morpholin-4-ylpentyl)carbamoylamino]phenyl]acetamide.
| Compound Name | N-[2-methoxy-4-[(4-methyl-2-morpholin-4-ylpentyl)carbamoylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 55744114 |
| Molecular Formula | C20H32N4O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | N-[2-methoxy-4-[(4-methyl-2-morpholin-4-ylpentyl)carbamoylamino]phenyl]acetamide |
| SMILES | COc1cc(NC(=O)NCC(CC(C)C)N2CCOCC2)ccc1NC(C)=O |
| InChI | InChI=1S/C20H32N4O4/c1-14(2)11-17(24-7-9-28-10-8-24)13-21-20(26)23-16-5-6-18(22-15(3)25)19(12-16)27-4/h5-6,12,14,17H,7-11,13H2,1-4H3,(H,22,25)(H2,21,23,26) |
| InChIKey | LNKWKTMTWWNHNU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |