C21H34N2O4 — CID 55520619
3-(3,4-dimethoxyphenyl)-N-(4-methyl-2-morpholin-4-ylpentyl)propanamide (PubChem CID 55520619) has the molecular formula C21H34N2O4 and a molecular weight of 378.51 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-(4-methyl-2-morpholin-4-ylpentyl)propanamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-(4-methyl-2-morpholin-4-ylpentyl)propanamide |
|---|---|
| PubChem CID | 55520619 |
| Molecular Formula | C21H34N2O4 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-(4-methyl-2-morpholin-4-ylpentyl)propanamide |
| SMILES | COc1ccc(CCC(=O)NCC(CC(C)C)N2CCOCC2)cc1OC |
| InChI | InChI=1S/C21H34N2O4/c1-16(2)13-18(23-9-11-27-12-10-23)15-22-21(24)8-6-17-5-7-19(25-3)20(14-17)26-4/h5,7,14,16,18H,6,8-13,15H2,1-4H3,(H,22,24) |
| InChIKey | ZJRVNYGSURKPQZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |