C22H31N5O3 — CID 52516653
1-[4-(1-methylimidazole-2-carbonyl)phenyl]-3-[(2R)-4-methyl-2-morpholin-4-ylpentyl]urea (PubChem CID 52516653) has the molecular formula C22H31N5O3 and a molecular weight of 413.52 g/mol. Its IUPAC name is 1-[4-(1-methylimidazole-2-carbonyl)phenyl]-3-[(2R)-4-methyl-2-morpholin-4-ylpentyl]urea.
| Compound Name | 1-[4-(1-methylimidazole-2-carbonyl)phenyl]-3-[(2R)-4-methyl-2-morpholin-4-ylpentyl]urea |
|---|---|
| PubChem CID | 52516653 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 1-[4-(1-methylimidazole-2-carbonyl)phenyl]-3-[(2R)-4-methyl-2-morpholin-4-ylpentyl]urea |
| SMILES | CC(C)C[C@H](CNC(=O)Nc1ccc(C(=O)c2nccn2C)cc1)N1CCOCC1 |
| InChI | InChI=1S/C22H31N5O3/c1-16(2)14-19(27-10-12-30-13-11-27)15-24-22(29)25-18-6-4-17(5-7-18)20(28)21-23-8-9-26(21)3/h4-9,16,19H,10-15H2,1-3H3,(H2,24,25,29)/t19-/m1/s1 |
| InChIKey | RPANCZYTDXMDDG-LJQANCHMSA-N |
| XLogP | 2.52 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |