C20H29FN6O — CID 51118030
1-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]urea (PubChem CID 51118030) has the molecular formula C20H29FN6O and a molecular weight of 388.49 g/mol. Its IUPAC name is 1-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]urea.
| Compound Name | 1-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]urea |
|---|---|
| PubChem CID | 51118030 |
| Molecular Formula | C20H29FN6O |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 1-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]urea |
| SMILES | Cc1[nH]ncc1CCCNC(=O)Nc1ccc(N2CCCN(C)CC2)c(F)c1 |
| InChI | InChI=1S/C20H29FN6O/c1-15-16(14-23-25-15)5-3-8-22-20(28)24-17-6-7-19(18(21)13-17)27-10-4-9-26(2)11-12-27/h6-7,13-14H,3-5,8-12H2,1-2H3,(H,23,25)(H2,22,24,28) |
| InChIKey | QVEYIXQDXWPGIK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|