C22H26F2N4O — CID 124721453
1-[(1S)-5-fluoro-2,3-dihydro-1H-inden-1-yl]-3-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]urea (PubChem CID 124721453) has the molecular formula C22H26F2N4O and a molecular weight of 400.47 g/mol. Its IUPAC name is 1-[(1S)-5-fluoro-2,3-dihydro-1H-inden-1-yl]-3-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]urea.
| Compound Name | 1-[(1S)-5-fluoro-2,3-dihydro-1H-inden-1-yl]-3-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 124721453 |
| Molecular Formula | C22H26F2N4O |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 1-[(1S)-5-fluoro-2,3-dihydro-1H-inden-1-yl]-3-[3-fluoro-4-(4-methyl-1,4-diazepan-1-yl)phenyl]urea |
| SMILES | CN1CCCN(c2ccc(NC(=O)N[C@H]3CCc4cc(F)ccc43)cc2F)CC1 |
| InChI | InChI=1S/C22H26F2N4O/c1-27-9-2-10-28(12-11-27)21-8-5-17(14-19(21)24)25-22(29)26-20-7-3-15-13-16(23)4-6-18(15)20/h4-6,8,13-14,20H,2-3,7,9-12H2,1H3,(H2,25,26,29)/t20-/m0/s1 |
| InChIKey | ADBORCLBYCLPMF-FQEVSTJZSA-N |
| XLogP | 3.92 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|