C20H23FN2O2S — CID 126483784
benzyl N-[3-fluoro-4-(1,5-thiazocan-5-yl)phenyl]carbamate (PubChem CID 126483784) has the molecular formula C20H23FN2O2S and a molecular weight of 374.48 g/mol. Its IUPAC name is benzyl N-[3-fluoro-4-(1,5-thiazocan-5-yl)phenyl]carbamate.
| Compound Name | benzyl N-[3-fluoro-4-(1,5-thiazocan-5-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 126483784 |
| Molecular Formula | C20H23FN2O2S |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | benzyl N-[3-fluoro-4-(1,5-thiazocan-5-yl)phenyl]carbamate |
| SMILES | O=C(Nc1ccc(N2CCCSCCC2)c(F)c1)OCc1ccccc1 |
| InChI | InChI=1S/C20H23FN2O2S/c21-18-14-17(22-20(24)25-15-16-6-2-1-3-7-16)8-9-19(18)23-10-4-12-26-13-5-11-23/h1-3,6-9,14H,4-5,10-13,15H2,(H,22,24) |
| InChIKey | WJZCIHNJXNPKQF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|