C18H18FNO3S — CID 140988545
benzyl N-[3-fluoro-4-(3-hydroxythiolan-3-yl)phenyl]carbamate (PubChem CID 140988545) has the molecular formula C18H18FNO3S and a molecular weight of 347.41 g/mol. Its IUPAC name is benzyl N-[3-fluoro-4-(3-hydroxythiolan-3-yl)phenyl]carbamate.
| Compound Name | benzyl N-[3-fluoro-4-(3-hydroxythiolan-3-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 140988545 |
| Molecular Formula | C18H18FNO3S |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | benzyl N-[3-fluoro-4-(3-hydroxythiolan-3-yl)phenyl]carbamate |
| SMILES | O=C(Nc1ccc(C2(O)CCSC2)c(F)c1)OCc1ccccc1 |
| InChI | InChI=1S/C18H18FNO3S/c19-16-10-14(6-7-15(16)18(22)8-9-24-12-18)20-17(21)23-11-13-4-2-1-3-5-13/h1-7,10,22H,8-9,11-12H2,(H,20,21) |
| InChIKey | OBBUYLVCKLXNHK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |