C20H20FNO4 — CID 67154749
ethyl 1-[2-fluoro-4-(phenylmethoxycarbonylamino)phenyl]cyclopropane-1-carboxylate (PubChem CID 67154749) has the molecular formula C20H20FNO4 and a molecular weight of 357.38 g/mol. Its IUPAC name is ethyl 1-[2-fluoro-4-(phenylmethoxycarbonylamino)phenyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl 1-[2-fluoro-4-(phenylmethoxycarbonylamino)phenyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 67154749 |
| Molecular Formula | C20H20FNO4 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | ethyl 1-[2-fluoro-4-(phenylmethoxycarbonylamino)phenyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(c2ccc(NC(=O)OCc3ccccc3)cc2F)CC1 |
| InChI | InChI=1S/C20H20FNO4/c1-2-25-18(23)20(10-11-20)16-9-8-15(12-17(16)21)22-19(24)26-13-14-6-4-3-5-7-14/h3-9,12H,2,10-11,13H2,1H3,(H,22,24) |
| InChIKey | NAPSVNZVJWIXGP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |