C23H23FN2O6 — CID 138546340
ethyl (6S)-6-[2-fluoro-5-(phenylmethoxycarbonylamino)phenyl]-6-methyl-2,4-dioxopiperidine-3-carboxylate (PubChem CID 138546340) has the molecular formula C23H23FN2O6 and a molecular weight of 442.44 g/mol. Its IUPAC name is ethyl (6S)-6-[2-fluoro-5-(phenylmethoxycarbonylamino)phenyl]-6-methyl-2,4-dioxopiperidine-3-carboxylate.
| Compound Name | ethyl (6S)-6-[2-fluoro-5-(phenylmethoxycarbonylamino)phenyl]-6-methyl-2,4-dioxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 138546340 |
| Molecular Formula | C23H23FN2O6 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | ethyl (6S)-6-[2-fluoro-5-(phenylmethoxycarbonylamino)phenyl]-6-methyl-2,4-dioxopiperidine-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)C[C@@](C)(c2cc(NC(=O)OCc3ccccc3)ccc2F)NC1=O |
| InChI | InChI=1S/C23H23FN2O6/c1-3-31-21(29)19-18(27)12-23(2,26-20(19)28)16-11-15(9-10-17(16)24)25-22(30)32-13-14-7-5-4-6-8-14/h4-11,19H,3,12-13H2,1-2H3,(H,25,30)(H,26,28)/t19?,23-/m0/s1 |
| InChIKey | QUWHYIHZEIZMDP-BVHINDKJSA-N |
| XLogP | 3.06 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|