C27H34N2O5 — CID 139959841
ethyl 7-[3,3-dimethyl-2-oxo-5-(phenylmethoxycarbonylamino)indol-1-yl]heptanoate (PubChem CID 139959841) has the molecular formula C27H34N2O5 and a molecular weight of 466.58 g/mol. Its IUPAC name is ethyl 7-[3,3-dimethyl-2-oxo-5-(phenylmethoxycarbonylamino)indol-1-yl]heptanoate.
| Compound Name | ethyl 7-[3,3-dimethyl-2-oxo-5-(phenylmethoxycarbonylamino)indol-1-yl]heptanoate |
|---|---|
| PubChem CID | 139959841 |
| Molecular Formula | C27H34N2O5 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | ethyl 7-[3,3-dimethyl-2-oxo-5-(phenylmethoxycarbonylamino)indol-1-yl]heptanoate |
| SMILES | CCOC(=O)CCCCCCN1C(=O)C(C)(C)c2cc(NC(=O)OCc3ccccc3)ccc21 |
| InChI | InChI=1S/C27H34N2O5/c1-4-33-24(30)14-10-5-6-11-17-29-23-16-15-21(18-22(23)27(2,3)25(29)31)28-26(32)34-19-20-12-8-7-9-13-20/h7-9,12-13,15-16,18H,4-6,10-11,14,17,19H2,1-3H3,(H,28,32) |
| InChIKey | YZHPJINBSZNOGG-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|