C15H24FN3O2S — CID 126495760
(2S)-N'-[3-fluoro-4-(1,5-thiazocan-5-yl)phenyl]-2-hydroperoxypropane-1,3-diamine (PubChem CID 126495760) has the molecular formula C15H24FN3O2S and a molecular weight of 329.44 g/mol. Its IUPAC name is (2S)-N'-[3-fluoro-4-(1,5-thiazocan-5-yl)phenyl]-2-hydroperoxypropane-1,3-diamine.
| Compound Name | (2S)-N'-[3-fluoro-4-(1,5-thiazocan-5-yl)phenyl]-2-hydroperoxypropane-1,3-diamine |
|---|---|
| PubChem CID | 126495760 |
| Molecular Formula | C15H24FN3O2S |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (2S)-N'-[3-fluoro-4-(1,5-thiazocan-5-yl)phenyl]-2-hydroperoxypropane-1,3-diamine |
| SMILES | NC[C@@H](CNc1ccc(N2CCCSCCC2)c(F)c1)OO |
| InChI | InChI=1S/C15H24FN3O2S/c16-14-9-12(18-11-13(10-17)21-20)3-4-15(14)19-5-1-7-22-8-2-6-19/h3-4,9,13,18,20H,1-2,5-8,10-11,17H2/t13-/m0/s1 |
| InChIKey | YDLWTQIGWMMJAG-ZDUSSCGKSA-N |
| XLogP | 2.39 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|