C18H25FN4O6 — CID 89072855
4-[5-[4-[[(2S)-3-amino-2-formyloxypropyl]amino]-2-fluorophenyl]-1,2,5-oxadiazepan-2-yl]-4-oxobutanoic acid (PubChem CID 89072855) has the molecular formula C18H25FN4O6 and a molecular weight of 412.42 g/mol. Its IUPAC name is 4-[5-[4-[[(2S)-3-amino-2-formyloxypropyl]amino]-2-fluorophenyl]-1,2,5-oxadiazepan-2-yl]-4-oxobutanoic acid.
| Compound Name | 4-[5-[4-[[(2S)-3-amino-2-formyloxypropyl]amino]-2-fluorophenyl]-1,2,5-oxadiazepan-2-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 89072855 |
| Molecular Formula | C18H25FN4O6 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 4-[5-[4-[[(2S)-3-amino-2-formyloxypropyl]amino]-2-fluorophenyl]-1,2,5-oxadiazepan-2-yl]-4-oxobutanoic acid |
| SMILES | NC[C@@H](CNc1ccc(N2CCON(C(=O)CCC(=O)O)CC2)c(F)c1)OC=O |
| InChI | InChI=1S/C18H25FN4O6/c19-15-9-13(21-11-14(10-20)28-12-24)1-2-16(15)22-5-6-23(29-8-7-22)17(25)3-4-18(26)27/h1-2,9,12,14,21H,3-8,10-11,20H2,(H,26,27)/t14-/m0/s1 |
| InChIKey | KUPMXYUAQFBRBY-AWEZNQCLSA-N |
| XLogP | 0.18 |
| TPSA | 134.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|