C24H30FN5O4 — CID 89072836
[(2R)-1-acetamido-3-[3-fluoro-4-[1-(2-phenylacetyl)-1,2,5-triazepan-5-yl]anilino]propan-2-yl] formate (PubChem CID 89072836) has the molecular formula C24H30FN5O4 and a molecular weight of 471.53 g/mol. Its IUPAC name is [(2R)-1-acetamido-3-[3-fluoro-4-[1-(2-phenylacetyl)-1,2,5-triazepan-5-yl]anilino]propan-2-yl] formate.
| Compound Name | [(2R)-1-acetamido-3-[3-fluoro-4-[1-(2-phenylacetyl)-1,2,5-triazepan-5-yl]anilino]propan-2-yl] formate |
|---|---|
| PubChem CID | 89072836 |
| Molecular Formula | C24H30FN5O4 |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | [(2R)-1-acetamido-3-[3-fluoro-4-[1-(2-phenylacetyl)-1,2,5-triazepan-5-yl]anilino]propan-2-yl] formate |
| SMILES | CC(=O)NC[C@@H](CNc1ccc(N2CCNN(C(=O)Cc3ccccc3)CC2)c(F)c1)OC=O |
| InChI | InChI=1S/C24H30FN5O4/c1-18(32)26-15-21(34-17-31)16-27-20-7-8-23(22(25)14-20)29-10-9-28-30(12-11-29)24(33)13-19-5-3-2-4-6-19/h2-8,14,17,21,27-28H,9-13,15-16H2,1H3,(H,26,32)/t21-/m0/s1 |
| InChIKey | CMNYARSWJSTCLP-NRFANRHFSA-N |
| XLogP | 1.31 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|