C20H24FN3O5 — CID 89083095
[(2R)-1-[3-fluoro-4-(2-hydroxyethylamino)anilino]-3-(phenylmethoxycarbonylamino)propan-2-yl] formate (PubChem CID 89083095) has the molecular formula C20H24FN3O5 and a molecular weight of 405.43 g/mol. Its IUPAC name is [(2R)-1-[3-fluoro-4-(2-hydroxyethylamino)anilino]-3-(phenylmethoxycarbonylamino)propan-2-yl] formate.
| Compound Name | [(2R)-1-[3-fluoro-4-(2-hydroxyethylamino)anilino]-3-(phenylmethoxycarbonylamino)propan-2-yl] formate |
|---|---|
| PubChem CID | 89083095 |
| Molecular Formula | C20H24FN3O5 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | [(2R)-1-[3-fluoro-4-(2-hydroxyethylamino)anilino]-3-(phenylmethoxycarbonylamino)propan-2-yl] formate |
| SMILES | O=CO[C@@H](CNC(=O)OCc1ccccc1)CNc1ccc(NCCO)c(F)c1 |
| InChI | InChI=1S/C20H24FN3O5/c21-18-10-16(6-7-19(18)22-8-9-25)23-11-17(29-14-26)12-24-20(27)28-13-15-4-2-1-3-5-15/h1-7,10,14,17,22-23,25H,8-9,11-13H2,(H,24,27)/t17-/m1/s1 |
| InChIKey | YODGYIQAQAPNBM-QGZVFWFLSA-N |
| XLogP | 2.11 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|