C26H39FN2O4 — CID 142559049
benzyl N-[1-[3-fluoro-4-(methylamino)phenyl]ethyl]carbamate;2,2-dimethylpropane;propan-2-yl formate (PubChem CID 142559049) has the molecular formula C26H39FN2O4 and a molecular weight of 462.61 g/mol. Its IUPAC name is benzyl N-[1-[3-fluoro-4-(methylamino)phenyl]ethyl]carbamate;2,2-dimethylpropane;propan-2-yl formate.
| Compound Name | benzyl N-[1-[3-fluoro-4-(methylamino)phenyl]ethyl]carbamate;2,2-dimethylpropane;propan-2-yl formate |
|---|---|
| PubChem CID | 142559049 |
| Molecular Formula | C26H39FN2O4 |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | benzyl N-[1-[3-fluoro-4-(methylamino)phenyl]ethyl]carbamate;2,2-dimethylpropane;propan-2-yl formate |
| SMILES | CC(C)(C)C.CC(C)OC=O.CNc1ccc(C(C)NC(=O)OCc2ccccc2)cc1F |
| InChI | InChI=1S/C17H19FN2O2.C5H12.C4H8O2/c1-12(14-8-9-16(19-2)15(18)10-14)20-17(21)22-11-13-6-4-3-5-7-13;1-5(2,3)4;1-4(2)6-3-5/h3-10,12,19H,11H2,1-2H3,(H,20,21);1-4H3;3-4H,1-2H3 |
| InChIKey | RNJAWVICTDTXNR-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|