C19H27F2N5O4 — CID 89072784
(5S)-5-(aminomethyl)-3-[3-fluoro-4-[2-[2-(3-fluoropropylamino)acetyl]-1,2,5-oxadiazepan-5-yl]phenyl]-1,3-oxazolidin-2-one (PubChem CID 89072784) has the molecular formula C19H27F2N5O4 and a molecular weight of 427.45 g/mol. Its IUPAC name is (5S)-5-(aminomethyl)-3-[3-fluoro-4-[2-[2-(3-fluoropropylamino)acetyl]-1,2,5-oxadiazepan-5-yl]phenyl]-1,3-oxazolidin-2-one.
| Compound Name | (5S)-5-(aminomethyl)-3-[3-fluoro-4-[2-[2-(3-fluoropropylamino)acetyl]-1,2,5-oxadiazepan-5-yl]phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 89072784 |
| Molecular Formula | C19H27F2N5O4 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | (5S)-5-(aminomethyl)-3-[3-fluoro-4-[2-[2-(3-fluoropropylamino)acetyl]-1,2,5-oxadiazepan-5-yl]phenyl]-1,3-oxazolidin-2-one |
| SMILES | NC[C@H]1CN(c2ccc(N3CCON(C(=O)CNCCCF)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C19H27F2N5O4/c20-4-1-5-23-12-18(27)26-7-6-24(8-9-29-26)17-3-2-14(10-16(17)21)25-13-15(11-22)30-19(25)28/h2-3,10,15,23H,1,4-9,11-13,22H2/t15-/m0/s1 |
| InChIKey | BKXIJQNQEQCYEC-HNNXBMFYSA-N |
| XLogP | 0.64 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|