C24H23F2N7O — CID 139408219
1-[5-fluoro-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]indole-3-carboxamide (PubChem CID 139408219) has the molecular formula C24H23F2N7O and a molecular weight of 463.49 g/mol. Its IUPAC name is 1-[5-fluoro-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]indole-3-carboxamide.
| Compound Name | 1-[5-fluoro-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]indole-3-carboxamide |
|---|---|
| PubChem CID | 139408219 |
| Molecular Formula | C24H23F2N7O |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 1-[5-fluoro-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]indole-3-carboxamide |
| SMILES | CN1CCN(c2ccc(Nc3ncc(F)c(-n4cc(C(N)=O)c5ccccc54)n3)cc2F)CC1 |
| InChI | InChI=1S/C24H23F2N7O/c1-31-8-10-32(11-9-31)21-7-6-15(12-18(21)25)29-24-28-13-19(26)23(30-24)33-14-17(22(27)34)16-4-2-3-5-20(16)33/h2-7,12-14H,8-11H2,1H3,(H2,27,34)(H,28,29,30) |
| InChIKey | JUKCOESRJKEEIH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|