C28H33N7O2 — CID 139408510
1-[2-[3-methoxy-4-[methyl(2-pyrrolidin-1-ylethyl)amino]anilino]-5-methylpyrimidin-4-yl]indole-3-carboxamide (PubChem CID 139408510) has the molecular formula C28H33N7O2 and a molecular weight of 499.62 g/mol. Its IUPAC name is 1-[2-[3-methoxy-4-[methyl(2-pyrrolidin-1-ylethyl)amino]anilino]-5-methylpyrimidin-4-yl]indole-3-carboxamide.
| Compound Name | 1-[2-[3-methoxy-4-[methyl(2-pyrrolidin-1-ylethyl)amino]anilino]-5-methylpyrimidin-4-yl]indole-3-carboxamide |
|---|---|
| PubChem CID | 139408510 |
| Molecular Formula | C28H33N7O2 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | 1-[2-[3-methoxy-4-[methyl(2-pyrrolidin-1-ylethyl)amino]anilino]-5-methylpyrimidin-4-yl]indole-3-carboxamide |
| SMILES | COc1cc(Nc2ncc(C)c(-n3cc(C(N)=O)c4ccccc43)n2)ccc1N(C)CCN1CCCC1 |
| InChI | InChI=1S/C28H33N7O2/c1-19-17-30-28(32-27(19)35-18-22(26(29)36)21-8-4-5-9-23(21)35)31-20-10-11-24(25(16-20)37-3)33(2)14-15-34-12-6-7-13-34/h4-5,8-11,16-18H,6-7,12-15H2,1-3H3,(H2,29,36)(H,30,31,32) |
| InChIKey | QSISAMAPNYZPNS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 101.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|