C27H30FN7O — CID 139408348
1-[5-fluoro-2-[4-[methyl(2-pyrrolidin-1-ylethyl)amino]anilino]pyrimidin-4-yl]-5H-cyclohepta[b]pyrrole-3-carboxamide (PubChem CID 139408348) has the molecular formula C27H30FN7O and a molecular weight of 487.58 g/mol. Its IUPAC name is 1-[5-fluoro-2-[4-[methyl(2-pyrrolidin-1-ylethyl)amino]anilino]pyrimidin-4-yl]-5H-cyclohepta[b]pyrrole-3-carboxamide.
| Compound Name | 1-[5-fluoro-2-[4-[methyl(2-pyrrolidin-1-ylethyl)amino]anilino]pyrimidin-4-yl]-5H-cyclohepta[b]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 139408348 |
| Molecular Formula | C27H30FN7O |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 1-[5-fluoro-2-[4-[methyl(2-pyrrolidin-1-ylethyl)amino]anilino]pyrimidin-4-yl]-5H-cyclohepta[b]pyrrole-3-carboxamide |
| SMILES | CN(CCN1CCCC1)c1ccc(Nc2ncc(F)c(-n3cc(C(N)=O)c4c3=CC=CCC=4)n2)cc1 |
| InChI | InChI=1S/C27H30FN7O/c1-33(15-16-34-13-5-6-14-34)20-11-9-19(10-12-20)31-27-30-17-23(28)26(32-27)35-18-22(25(29)36)21-7-3-2-4-8-24(21)35/h2,4,7-12,17-18H,3,5-6,13-16H2,1H3,(H2,29,36)(H,30,31,32) |
| InChIKey | IMCZYAVTLQKBAI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|