C18H23N7O2 — CID 66792045
2-[4-[(3-amino-3-oxopropyl)-methylamino]anilino]-4-(cyclopropylamino)pyrimidine-5-carboxamide (PubChem CID 66792045) has the molecular formula C18H23N7O2 and a molecular weight of 369.43 g/mol. Its IUPAC name is 2-[4-[(3-amino-3-oxopropyl)-methylamino]anilino]-4-(cyclopropylamino)pyrimidine-5-carboxamide.
| Compound Name | 2-[4-[(3-amino-3-oxopropyl)-methylamino]anilino]-4-(cyclopropylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 66792045 |
| Molecular Formula | C18H23N7O2 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 2-[4-[(3-amino-3-oxopropyl)-methylamino]anilino]-4-(cyclopropylamino)pyrimidine-5-carboxamide |
| SMILES | CN(CCC(N)=O)c1ccc(Nc2ncc(C(N)=O)c(NC3CC3)n2)cc1 |
| InChI | InChI=1S/C18H23N7O2/c1-25(9-8-15(19)26)13-6-4-12(5-7-13)23-18-21-10-14(16(20)27)17(24-18)22-11-2-3-11/h4-7,10-11H,2-3,8-9H2,1H3,(H2,19,26)(H2,20,27)(H2,21,22,23,24) |
| InChIKey | ZTYGMNCXGRTDBW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 139.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|