C17H22N6O4S — CID 58014791
4-(cyclopropylamino)-2-[4-(2-methoxyethylsulfamoyl)anilino]pyrimidine-5-carboxamide (PubChem CID 58014791) has the molecular formula C17H22N6O4S and a molecular weight of 406.47 g/mol. Its IUPAC name is 4-(cyclopropylamino)-2-[4-(2-methoxyethylsulfamoyl)anilino]pyrimidine-5-carboxamide.
| Compound Name | 4-(cyclopropylamino)-2-[4-(2-methoxyethylsulfamoyl)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 58014791 |
| Molecular Formula | C17H22N6O4S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 4-(cyclopropylamino)-2-[4-(2-methoxyethylsulfamoyl)anilino]pyrimidine-5-carboxamide |
| SMILES | COCCNS(=O)(=O)c1ccc(Nc2ncc(C(N)=O)c(NC3CC3)n2)cc1 |
| InChI | InChI=1S/C17H22N6O4S/c1-27-9-8-20-28(25,26)13-6-4-12(5-7-13)22-17-19-10-14(15(18)24)16(23-17)21-11-2-3-11/h4-7,10-11,20H,2-3,8-9H2,1H3,(H2,18,24)(H2,19,21,22,23) |
| InChIKey | YXQVTLSZASOYQR-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 148.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|