C16H18N4O3S — CID 67678495
1-[4-(cyclopropylamino)-2-(4-methylsulfonylanilino)pyrimidin-5-yl]ethanone (PubChem CID 67678495) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is 1-[4-(cyclopropylamino)-2-(4-methylsulfonylanilino)pyrimidin-5-yl]ethanone.
| Compound Name | 1-[4-(cyclopropylamino)-2-(4-methylsulfonylanilino)pyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 67678495 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 1-[4-(cyclopropylamino)-2-(4-methylsulfonylanilino)pyrimidin-5-yl]ethanone |
| SMILES | CC(=O)c1cnc(Nc2ccc(S(C)(=O)=O)cc2)nc1NC1CC1 |
| InChI | InChI=1S/C16H18N4O3S/c1-10(21)14-9-17-16(20-15(14)18-11-3-4-11)19-12-5-7-13(8-6-12)24(2,22)23/h5-9,11H,3-4H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | HVMKJLFMNYZMSZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |