C26H29N7O2 — CID 139408520
1-[2-[3-[4-(2-methoxyethyl)piperazin-1-yl]anilino]pyrimidin-4-yl]indole-3-carboxamide (PubChem CID 139408520) has the molecular formula C26H29N7O2 and a molecular weight of 471.57 g/mol. Its IUPAC name is 1-[2-[3-[4-(2-methoxyethyl)piperazin-1-yl]anilino]pyrimidin-4-yl]indole-3-carboxamide.
| Compound Name | 1-[2-[3-[4-(2-methoxyethyl)piperazin-1-yl]anilino]pyrimidin-4-yl]indole-3-carboxamide |
|---|---|
| PubChem CID | 139408520 |
| Molecular Formula | C26H29N7O2 |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 1-[2-[3-[4-(2-methoxyethyl)piperazin-1-yl]anilino]pyrimidin-4-yl]indole-3-carboxamide |
| SMILES | COCCN1CCN(c2cccc(Nc3nccc(-n4cc(C(N)=O)c5ccccc54)n3)c2)CC1 |
| InChI | InChI=1S/C26H29N7O2/c1-35-16-15-31-11-13-32(14-12-31)20-6-4-5-19(17-20)29-26-28-10-9-24(30-26)33-18-22(25(27)34)21-7-2-3-8-23(21)33/h2-10,17-18H,11-16H2,1H3,(H2,27,34)(H,28,29,30) |
| InChIKey | MJGTZNRBPGOZCT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 101.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |