C27H29N7O2 — CID 139408146
1-[2-[4-[4-(1-hydroxyprop-2-enyl)piperazin-1-yl]-3-methylanilino]pyrimidin-4-yl]indole-3-carboxamide (PubChem CID 139408146) has the molecular formula C27H29N7O2 and a molecular weight of 483.58 g/mol. Its IUPAC name is 1-[2-[4-[4-(1-hydroxyprop-2-enyl)piperazin-1-yl]-3-methylanilino]pyrimidin-4-yl]indole-3-carboxamide.
| Compound Name | 1-[2-[4-[4-(1-hydroxyprop-2-enyl)piperazin-1-yl]-3-methylanilino]pyrimidin-4-yl]indole-3-carboxamide |
|---|---|
| PubChem CID | 139408146 |
| Molecular Formula | C27H29N7O2 |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 1-[2-[4-[4-(1-hydroxyprop-2-enyl)piperazin-1-yl]-3-methylanilino]pyrimidin-4-yl]indole-3-carboxamide |
| SMILES | C=CC(O)N1CCN(c2ccc(Nc3nccc(-n4cc(C(N)=O)c5ccccc54)n3)cc2C)CC1 |
| InChI | InChI=1S/C27H29N7O2/c1-3-25(35)33-14-12-32(13-15-33)22-9-8-19(16-18(22)2)30-27-29-11-10-24(31-27)34-17-21(26(28)36)20-6-4-5-7-23(20)34/h3-11,16-17,25,35H,1,12-15H2,2H3,(H2,28,36)(H,29,30,31) |
| InChIKey | OFLGWDFHUNAXDF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 112.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|