C19H16N8O — CID 151984631
N-(cyanomethyl)-1-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]indole-3-carboxamide (PubChem CID 151984631) has the molecular formula C19H16N8O and a molecular weight of 372.39 g/mol. Its IUPAC name is N-(cyanomethyl)-1-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]indole-3-carboxamide.
| Compound Name | N-(cyanomethyl)-1-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]indole-3-carboxamide |
|---|---|
| PubChem CID | 151984631 |
| Molecular Formula | C19H16N8O |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | N-(cyanomethyl)-1-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]indole-3-carboxamide |
| SMILES | Cn1cc(Nc2nccc(-n3cc(C(=O)NCC#N)c4ccccc43)n2)cn1 |
| InChI | InChI=1S/C19H16N8O/c1-26-11-13(10-23-26)24-19-22-8-6-17(25-19)27-12-15(18(28)21-9-7-20)14-4-2-3-5-16(14)27/h2-6,8,10-12H,9H2,1H3,(H,21,28)(H,22,24,25) |
| InChIKey | UDKDJWBXKZGKKJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|