C24H24FN7O — CID 139408270
1-[2-[3-fluoro-5-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]indole-3-carboxamide (PubChem CID 139408270) has the molecular formula C24H24FN7O and a molecular weight of 445.50 g/mol. Its IUPAC name is 1-[2-[3-fluoro-5-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]indole-3-carboxamide.
| Compound Name | 1-[2-[3-fluoro-5-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]indole-3-carboxamide |
|---|---|
| PubChem CID | 139408270 |
| Molecular Formula | C24H24FN7O |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 1-[2-[3-fluoro-5-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]indole-3-carboxamide |
| SMILES | CN1CCN(c2cc(F)cc(Nc3nccc(-n4cc(C(N)=O)c5ccccc54)n3)c2)CC1 |
| InChI | InChI=1S/C24H24FN7O/c1-30-8-10-31(11-9-30)18-13-16(25)12-17(14-18)28-24-27-7-6-22(29-24)32-15-20(23(26)33)19-4-2-3-5-21(19)32/h2-7,12-15H,8-11H2,1H3,(H2,26,33)(H,27,28,29) |
| InChIKey | XGQHBBDCLJRSLO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |