C23H22ClN7O — CID 161028650
1-[5-chloro-2-[(5-piperidin-1-yl-2-pyridinyl)amino]pyrimidin-4-yl]indole-3-carboxamide (PubChem CID 161028650) has the molecular formula C23H22ClN7O and a molecular weight of 447.93 g/mol. Its IUPAC name is 1-[5-chloro-2-[(5-piperidin-1-yl-2-pyridinyl)amino]pyrimidin-4-yl]indole-3-carboxamide.
| Compound Name | 1-[5-chloro-2-[(5-piperidin-1-yl-2-pyridinyl)amino]pyrimidin-4-yl]indole-3-carboxamide |
|---|---|
| PubChem CID | 161028650 |
| Molecular Formula | C23H22ClN7O |
| Molecular Weight | 447.93 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 1-[5-chloro-2-[(5-piperidin-1-yl-2-pyridinyl)amino]pyrimidin-4-yl]indole-3-carboxamide |
| SMILES | NC(=O)c1cn(-c2nc(Nc3ccc(N4CCCCC4)cn3)ncc2Cl)c2ccccc12 |
| InChI | InChI=1S/C23H22ClN7O/c24-18-13-27-23(28-20-9-8-15(12-26-20)30-10-4-1-5-11-30)29-22(18)31-14-17(21(25)32)16-6-2-3-7-19(16)31/h2-3,6-9,12-14H,1,4-5,10-11H2,(H2,25,32)(H,26,27,28,29) |
| InChIKey | AMYOKVGZSYAZJB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.93 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |