C19H22FN3O — CID 113031077
N-[5-(azepan-1-yl)-2-pyridinyl]-2-(2-fluorophenyl)acetamide (PubChem CID 113031077) has the molecular formula C19H22FN3O and a molecular weight of 327.40 g/mol. Its IUPAC name is N-[5-(azepan-1-yl)-2-pyridinyl]-2-(2-fluorophenyl)acetamide.
| Compound Name | N-[5-(azepan-1-yl)-2-pyridinyl]-2-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 113031077 |
| Molecular Formula | C19H22FN3O |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | N-[5-(azepan-1-yl)-2-pyridinyl]-2-(2-fluorophenyl)acetamide |
| SMILES | O=C(Cc1ccccc1F)Nc1ccc(N2CCCCCC2)cn1 |
| InChI | InChI=1S/C19H22FN3O/c20-17-8-4-3-7-15(17)13-19(24)22-18-10-9-16(14-21-18)23-11-5-1-2-6-12-23/h3-4,7-10,14H,1-2,5-6,11-13H2,(H,21,22,24) |
| InChIKey | BNFVIHKAJCATGH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |