C23H26N4O3 — CID 39072386
N-[5-(azepan-1-yl)-2-pyridinyl]-4-(1,3-dioxoisoindol-2-yl)butanamide (PubChem CID 39072386) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is N-[5-(azepan-1-yl)-2-pyridinyl]-4-(1,3-dioxoisoindol-2-yl)butanamide.
| Compound Name | N-[5-(azepan-1-yl)-2-pyridinyl]-4-(1,3-dioxoisoindol-2-yl)butanamide |
|---|---|
| PubChem CID | 39072386 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | N-[5-(azepan-1-yl)-2-pyridinyl]-4-(1,3-dioxoisoindol-2-yl)butanamide |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)Nc1ccc(N2CCCCCC2)cn1 |
| InChI | InChI=1S/C23H26N4O3/c28-21(10-7-15-27-22(29)18-8-3-4-9-19(18)23(27)30)25-20-12-11-17(16-24-20)26-13-5-1-2-6-14-26/h3-4,8-9,11-12,16H,1-2,5-7,10,13-15H2,(H,24,25,28) |
| InChIKey | CYDSVCKPISWORM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|