C21H22N4O3 — CID 39072303
N-[5-(azepan-1-yl)-2-pyridinyl]-2-(1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 39072303) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-[5-(azepan-1-yl)-2-pyridinyl]-2-(1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-[5-(azepan-1-yl)-2-pyridinyl]-2-(1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 39072303 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | N-[5-(azepan-1-yl)-2-pyridinyl]-2-(1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)Nc1ccc(N2CCCCCC2)cn1 |
| InChI | InChI=1S/C21H22N4O3/c26-19(14-25-20(27)16-7-3-4-8-17(16)21(25)28)23-18-10-9-15(13-22-18)24-11-5-1-2-6-12-24/h3-4,7-10,13H,1-2,5-6,11-12,14H2,(H,22,23,26) |
| InChIKey | FNAXITCUWWTBIW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|