C23H21FN6O — CID 139408396
1-[5-fluoro-2-(3-piperazin-1-ylanilino)pyrimidin-4-yl]indole-3-carbaldehyde (PubChem CID 139408396) has the molecular formula C23H21FN6O and a molecular weight of 416.46 g/mol. Its IUPAC name is 1-[5-fluoro-2-(3-piperazin-1-ylanilino)pyrimidin-4-yl]indole-3-carbaldehyde.
| Compound Name | 1-[5-fluoro-2-(3-piperazin-1-ylanilino)pyrimidin-4-yl]indole-3-carbaldehyde |
|---|---|
| PubChem CID | 139408396 |
| Molecular Formula | C23H21FN6O |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 1-[5-fluoro-2-(3-piperazin-1-ylanilino)pyrimidin-4-yl]indole-3-carbaldehyde |
| SMILES | O=Cc1cn(-c2nc(Nc3cccc(N4CCNCC4)c3)ncc2F)c2ccccc12 |
| InChI | InChI=1S/C23H21FN6O/c24-20-13-26-23(27-17-4-3-5-18(12-17)29-10-8-25-9-11-29)28-22(20)30-14-16(15-31)19-6-1-2-7-21(19)30/h1-7,12-15,25H,8-11H2,(H,26,27,28) |
| InChIKey | CPBMFQLSSWRKDX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|