C26H29F2N7O2S — CID 153465900
N-[3-[2-(3,5-difluoro-4-piperazin-1-ylanilino)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-2-methylpropane-2-sulfonamide (PubChem CID 153465900) has the molecular formula C26H29F2N7O2S and a molecular weight of 541.63 g/mol. Its IUPAC name is N-[3-[2-(3,5-difluoro-4-piperazin-1-ylanilino)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[3-[2-(3,5-difluoro-4-piperazin-1-ylanilino)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 153465900 |
| Molecular Formula | C26H29F2N7O2S |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | N-[3-[2-(3,5-difluoro-4-piperazin-1-ylanilino)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-2-methylpropane-2-sulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)Nc1cccc(-n2ccc3cnc(Nc4cc(F)c(N5CCNCC5)c(F)c4)nc32)c1 |
| InChI | InChI=1S/C26H29F2N7O2S/c1-26(2,3)38(36,37)33-18-5-4-6-20(13-18)35-10-7-17-16-30-25(32-24(17)35)31-19-14-21(27)23(22(28)15-19)34-11-8-29-9-12-34/h4-7,10,13-16,29,33H,8-9,11-12H2,1-3H3,(H,30,31,32) |
| InChIKey | JPGMMUVXVRNJDM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|