C26H31N7O2S — CID 153465767
2-methyl-N-[3-[2-(4-piperazin-1-ylanilino)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]propane-2-sulfonamide (PubChem CID 153465767) has the molecular formula C26H31N7O2S and a molecular weight of 505.65 g/mol. Its IUPAC name is 2-methyl-N-[3-[2-(4-piperazin-1-ylanilino)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]propane-2-sulfonamide.
| Compound Name | 2-methyl-N-[3-[2-(4-piperazin-1-ylanilino)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 153465767 |
| Molecular Formula | C26H31N7O2S |
| Molecular Weight | 505.65 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | 2-methyl-N-[3-[2-(4-piperazin-1-ylanilino)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]propane-2-sulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)Nc1cccc(-n2ccc3cnc(Nc4ccc(N5CCNCC5)cc4)nc32)c1 |
| InChI | InChI=1S/C26H31N7O2S/c1-26(2,3)36(34,35)31-21-5-4-6-23(17-21)33-14-11-19-18-28-25(30-24(19)33)29-20-7-9-22(10-8-20)32-15-12-27-13-16-32/h4-11,14,17-18,27,31H,12-13,15-16H2,1-3H3,(H,28,29,30) |
| InChIKey | LNZCDGDICMLHLC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.65 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|