C27H32FN7O2S — CID 153465868
N-[3-[2-(3-fluoro-4-piperazin-1-ylanilino)-5-methylpyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-2-methylpropane-2-sulfonamide (PubChem CID 153465868) has the molecular formula C27H32FN7O2S and a molecular weight of 537.67 g/mol. Its IUPAC name is N-[3-[2-(3-fluoro-4-piperazin-1-ylanilino)-5-methylpyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[3-[2-(3-fluoro-4-piperazin-1-ylanilino)-5-methylpyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 153465868 |
| Molecular Formula | C27H32FN7O2S |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | N-[3-[2-(3-fluoro-4-piperazin-1-ylanilino)-5-methylpyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-2-methylpropane-2-sulfonamide |
| SMILES | Cc1cn(-c2cccc(NS(=O)(=O)C(C)(C)C)c2)c2nc(Nc3ccc(N4CCNCC4)c(F)c3)ncc12 |
| InChI | InChI=1S/C27H32FN7O2S/c1-18-17-35(21-7-5-6-20(14-21)33-38(36,37)27(2,3)4)25-22(18)16-30-26(32-25)31-19-8-9-24(23(28)15-19)34-12-10-29-11-13-34/h5-9,14-17,29,33H,10-13H2,1-4H3,(H,30,31,32) |
| InChIKey | IBDJRMMDCDUCFO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|