C24H32N6O — CID 157148191
methane;N-(3-piperazin-1-ylphenyl)-7-piperidin-4-yloxyquinazolin-2-amine (PubChem CID 157148191) has the molecular formula C24H32N6O and a molecular weight of 420.56 g/mol. Its IUPAC name is methane;N-(3-piperazin-1-ylphenyl)-7-piperidin-4-yloxyquinazolin-2-amine.
| Compound Name | methane;N-(3-piperazin-1-ylphenyl)-7-piperidin-4-yloxyquinazolin-2-amine |
|---|---|
| PubChem CID | 157148191 |
| Molecular Formula | C24H32N6O |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | methane;N-(3-piperazin-1-ylphenyl)-7-piperidin-4-yloxyquinazolin-2-amine |
| SMILES | C.c1cc(Nc2ncc3ccc(OC4CCNCC4)cc3n2)cc(N2CCNCC2)c1 |
| InChI | InChI=1S/C23H28N6O.CH4/c1-2-18(14-19(3-1)29-12-10-25-11-13-29)27-23-26-16-17-4-5-21(15-22(17)28-23)30-20-6-8-24-9-7-20;/h1-5,14-16,20,24-25H,6-13H2,(H,26,27,28);1H4 |
| InChIKey | AKYHLZUKMJFMRH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 74.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |