C23H28N4O3S — CID 67102202
N-(4-methylsulfonylphenyl)-7-(1-propan-2-ylpiperidin-4-yl)oxyquinazolin-2-amine (PubChem CID 67102202) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is N-(4-methylsulfonylphenyl)-7-(1-propan-2-ylpiperidin-4-yl)oxyquinazolin-2-amine.
| Compound Name | N-(4-methylsulfonylphenyl)-7-(1-propan-2-ylpiperidin-4-yl)oxyquinazolin-2-amine |
|---|---|
| PubChem CID | 67102202 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | N-(4-methylsulfonylphenyl)-7-(1-propan-2-ylpiperidin-4-yl)oxyquinazolin-2-amine |
| SMILES | CC(C)N1CCC(Oc2ccc3cnc(Nc4ccc(S(C)(=O)=O)cc4)nc3c2)CC1 |
| InChI | InChI=1S/C23H28N4O3S/c1-16(2)27-12-10-19(11-13-27)30-20-7-4-17-15-24-23(26-22(17)14-20)25-18-5-8-21(9-6-18)31(3,28)29/h4-9,14-16,19H,10-13H2,1-3H3,(H,24,25,26) |
| InChIKey | OZKJWISUSMNPKF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |