C26H34N6O2 — CID 89102571
2-N-(4-morpholin-4-ylphenyl)-8-(1-propan-2-ylpiperidin-4-yl)oxyquinazoline-2,6-diamine (PubChem CID 89102571) has the molecular formula C26H34N6O2 and a molecular weight of 462.60 g/mol. Its IUPAC name is 2-N-(4-morpholin-4-ylphenyl)-8-(1-propan-2-ylpiperidin-4-yl)oxyquinazoline-2,6-diamine.
| Compound Name | 2-N-(4-morpholin-4-ylphenyl)-8-(1-propan-2-ylpiperidin-4-yl)oxyquinazoline-2,6-diamine |
|---|---|
| PubChem CID | 89102571 |
| Molecular Formula | C26H34N6O2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | 2-N-(4-morpholin-4-ylphenyl)-8-(1-propan-2-ylpiperidin-4-yl)oxyquinazoline-2,6-diamine |
| SMILES | CC(C)N1CCC(Oc2cc(N)cc3cnc(Nc4ccc(N5CCOCC5)cc4)nc23)CC1 |
| InChI | InChI=1S/C26H34N6O2/c1-18(2)31-9-7-23(8-10-31)34-24-16-20(27)15-19-17-28-26(30-25(19)24)29-21-3-5-22(6-4-21)32-11-13-33-14-12-32/h3-6,15-18,23H,7-14,27H2,1-2H3,(H,28,29,30) |
| InChIKey | DDWDFTHGPFAXSM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|