C29H32N6O — CID 175553560
N-[3-(4-methylpiperazin-1-yl)phenyl]-7-(4-morpholin-2-ylphenyl)quinazolin-2-amine (PubChem CID 175553560) has the molecular formula C29H32N6O and a molecular weight of 480.62 g/mol. Its IUPAC name is N-[3-(4-methylpiperazin-1-yl)phenyl]-7-(4-morpholin-2-ylphenyl)quinazolin-2-amine.
| Compound Name | N-[3-(4-methylpiperazin-1-yl)phenyl]-7-(4-morpholin-2-ylphenyl)quinazolin-2-amine |
|---|---|
| PubChem CID | 175553560 |
| Molecular Formula | C29H32N6O |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | N-[3-(4-methylpiperazin-1-yl)phenyl]-7-(4-morpholin-2-ylphenyl)quinazolin-2-amine |
| SMILES | CN1CCN(c2cccc(Nc3ncc4ccc(-c5ccc(C6CNCCO6)cc5)cc4n3)c2)CC1 |
| InChI | InChI=1S/C29H32N6O/c1-34-12-14-35(15-13-34)26-4-2-3-25(18-26)32-29-31-19-24-10-9-23(17-27(24)33-29)21-5-7-22(8-6-21)28-20-30-11-16-36-28/h2-10,17-19,28,30H,11-16,20H2,1H3,(H,31,32,33) |
| InChIKey | YHDZJHVBIPUZQY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |