About 6-[[5-fluoro-2-(3-piperazin-1-ylanilino)pyrimidin-4-yl]amino]-4H-1,4-benzoxazin-3-one
6-[[5-fluoro-2-(3-piperazin-1-ylanilino)pyrimidin-4-yl]amino]-4H-1,4-benzoxazin-3-one (PubChem CID 59405686) has the molecular formula C22H22FN7O2
and a molecular weight of 435.46 g/mol. Its IUPAC name is 6-[[5-fluoro-2-(3-piperazin-1-ylanilino)pyrimidin-4-yl]amino]-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 6-[[5-fluoro-2-(3-piperazin-1-ylanilino)pyrimidin-4-yl]amino]-4H-1,4-benzoxazin-3-one |
| PubChem CID | 59405686 |
| Molecular Formula | C22H22FN7O2 |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 6-[[5-fluoro-2-(3-piperazin-1-ylanilino)pyrimidin-4-yl]amino]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(Nc3nc(Nc4cccc(N5CCNCC5)c4)ncc3F)cc2N1 |
| InChI | InChI=1S/C22H22FN7O2/c23-17-12-25-22(27-14-2-1-3-16(10-14)30-8-6-24-7-9-30)29-21(17)26-15-4-5-19-18(11-15)28-20(31)13-32-19/h1-5,10-12,24H,6-9,13H2,(H,28,31)(H2,25,26,27,29) |
| InChIKey | RJSOBWAHACZBKV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 6-[[5-fluoro-2-(3-piperazin-1-ylanilino)pyrimidin-4-yl]amino]-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[5-fluoro-2-(3-piperazin-1-ylanilino)pyrimidin-4-yl]amino]-4H-1,4-benzoxazin-3-one?
The IUPAC name of 6-[[5-fluoro-2-(3-piperazin-1-ylanilino)pyrimidin-4-yl]amino]-4H-1,4-benzoxazin-3-one (CID 59405686) is 6-[[5-fluoro-2-(3-piperazin-1-ylanilino)pyrimidin-4-yl]amino]-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 6-[[5-fluoro-2-(3-piperazin-1-ylanilino)pyrimidin-4-yl]amino]-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 6-[[5-fluoro-2-(3-piperazin-1-ylanilino)pyrimidin-4-yl]amino]-4H-1,4-benzoxazin-3-one is O=C1COc2ccc(Nc3nc(Nc4cccc(N5CCNCC5)c4)ncc3F)cc2N1.
What is the InChIKey of 6-[[5-fluoro-2-(3-piperazin-1-ylanilino)pyrimidin-4-yl]amino]-4H-1,4-benzoxazin-3-one?
The InChIKey is RJSOBWAHACZBKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22FN7O2/c23-17-12-25-22(27-14-2-1-3-16(10-14)30-8-6-24-7-9-30)29-21(17)26-15-4-5-19-18(11-15)28-20(31)13-32-19/h1-5,10-12,24H,6-9,13H2,(H,28,31)(H2,25,26,27,29).
What are the key properties of 6-[[5-fluoro-2-(3-piperazin-1-ylanilino)pyrimidin-4-yl]amino]-4H-1,4-benzoxazin-3-one?
6-[[5-fluoro-2-(3-piperazin-1-ylanilino)pyrimidin-4-yl]amino]-4H-1,4-benzoxazin-3-one has a molecular weight of 435.46 g/mol, XLogP of 2.84, 5 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[5-fluoro-2-(3-piperazin-1-ylanilino)pyrimidin-4-yl]amino]-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 59405686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).