C22H24FN9 — CID 118420828
9-(3-aminophenyl)-2-N-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]purine-2,6-diamine (PubChem CID 118420828) has the molecular formula C22H24FN9 and a molecular weight of 433.50 g/mol. Its IUPAC name is 9-(3-aminophenyl)-2-N-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]purine-2,6-diamine.
| Compound Name | 9-(3-aminophenyl)-2-N-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]purine-2,6-diamine |
|---|---|
| PubChem CID | 118420828 |
| Molecular Formula | C22H24FN9 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 9-(3-aminophenyl)-2-N-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]purine-2,6-diamine |
| SMILES | CN1CCN(c2ccc(Nc3nc(N)c4ncn(-c5cccc(N)c5)c4n3)cc2F)CC1 |
| InChI | InChI=1S/C22H24FN9/c1-30-7-9-31(10-8-30)18-6-5-15(12-17(18)23)27-22-28-20(25)19-21(29-22)32(13-26-19)16-4-2-3-14(24)11-16/h2-6,11-13H,7-10,24H2,1H3,(H3,25,27,28,29) |
| InChIKey | BVRLPJBXHYXYGD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|