C23H24FN7 — CID 25007119
2-[3-[[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]acetonitrile (PubChem CID 25007119) has the molecular formula C23H24FN7 and a molecular weight of 417.49 g/mol. Its IUPAC name is 2-[3-[[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]acetonitrile.
| Compound Name | 2-[3-[[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]acetonitrile |
|---|---|
| PubChem CID | 25007119 |
| Molecular Formula | C23H24FN7 |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 2-[3-[[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]acetonitrile |
| SMILES | CN1CCN(c2ccc(Nc3nccc(Nc4cccc(CC#N)c4)n3)cc2F)CC1 |
| InChI | InChI=1S/C23H24FN7/c1-30-11-13-31(14-12-30)21-6-5-19(16-20(21)24)28-23-26-10-8-22(29-23)27-18-4-2-3-17(15-18)7-9-25/h2-6,8,10,15-16H,7,11-14H2,1H3,(H2,26,27,28,29) |
| InChIKey | XIRBCBGZVWSHJO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 80.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|