C13H12N4 — CID 143930397
2-[3-[(2-methylpyrimidin-4-yl)amino]phenyl]acetonitrile (PubChem CID 143930397) has the molecular formula C13H12N4 and a molecular weight of 224.27 g/mol. Its IUPAC name is 2-[3-[(2-methylpyrimidin-4-yl)amino]phenyl]acetonitrile.
| Compound Name | 2-[3-[(2-methylpyrimidin-4-yl)amino]phenyl]acetonitrile |
|---|---|
| PubChem CID | 143930397 |
| Molecular Formula | C13H12N4 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 2-[3-[(2-methylpyrimidin-4-yl)amino]phenyl]acetonitrile |
| SMILES | Cc1nccc(Nc2cccc(CC#N)c2)n1 |
| InChI | InChI=1S/C13H12N4/c1-10-15-8-6-13(16-10)17-12-4-2-3-11(9-12)5-7-14/h2-4,6,8-9H,5H2,1H3,(H,15,16,17) |
| InChIKey | MEHMPISHCSVSNQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |